CymitQuimica logo

CAS 1206969-17-6

:

N,N-Dimethyl-3-pyrrolidinesulfonamide

Description:
N,N-Dimethyl-3-pyrrolidinesulfonamide is a chemical compound characterized by its sulfonamide functional group attached to a pyrrolidine ring. This compound typically exhibits properties associated with sulfonamides, such as potential antimicrobial activity, although its specific biological activity may vary. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the dimethyl groups contributes to its lipophilicity, which can influence its solubility in organic solvents and its permeability through biological membranes. The pyrrolidine ring structure provides a degree of rigidity and can participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, the sulfonamide moiety can engage in hydrogen bonding, which may enhance its interactions with biological targets. Overall, N,N-Dimethyl-3-pyrrolidinesulfonamide is of interest in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of more complex pharmaceutical agents.
Formula:C6H14N2O2S
InChI:InChI=1S/C6H14N2O2S/c1-8(2)11(9,10)6-3-4-7-5-6/h6-7H,3-5H2,1-2H3
InChI key:InChIKey=YQDAMPMHGDNPED-UHFFFAOYSA-N
SMILES:S(N(C)C)(=O)(=O)C1CCNC1
Synonyms:
  • 3-Pyrrolidinesulfonamide, N,N-dimethyl-
  • N,N-Dimethyl-3-pyrrolidinesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.