CAS 1206969-26-7
:1-Methylethyl 4-[4-(aminomethyl)-1H-pyrazol-1-yl]-1-piperidinecarboxylate
Description:
1-Methylethyl 4-[4-(aminomethyl)-1H-pyrazol-1-yl]-1-piperidinecarboxylate, with the CAS number 1206969-26-7, is a chemical compound that features a complex structure incorporating a piperidine ring and a pyrazole moiety. This substance is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the aminomethyl group suggests it may interact with various biological targets, potentially influencing neurotransmitter systems or other pathways. The ester functional group in the piperidinecarboxylate structure may contribute to its solubility and reactivity, making it a candidate for further chemical modifications. Additionally, the compound's molecular structure indicates it may exhibit specific stereochemical properties, which can affect its biological activity and interactions. Overall, this compound represents a class of molecules that could be of interest in drug discovery and development, particularly in the context of neuropharmacology or related fields.
Formula:C13H22N4O2
InChI:InChI=1S/C13H22N4O2/c1-10(2)19-13(18)16-5-3-12(4-6-16)17-9-11(7-14)8-15-17/h8-10,12H,3-7,14H2,1-2H3
InChI key:InChIKey=ODWLMVRVNRAFIK-UHFFFAOYSA-N
SMILES:C(N)C1=CN(N=C1)C2CCN(C(OC(C)C)=O)CC2
Synonyms:- 1-Methylethyl 4-[4-(aminomethyl)-1H-pyrazol-1-yl]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 4-[4-(aminomethyl)-1H-pyrazol-1-yl]-, 1-methylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Isopropyl 4-(4-(aminomethyl)-1H-pyrazol-1-yl)piperidine-1-carboxylate
CAS:Isopropyl 4-(4-(aminomethyl)-1H-pyrazol-1-yl)piperidine-1-carboxylate
Molecular weight:266.34g/mol
