CAS 1206969-36-9
:6-Chloro-1,8a-dihydro-2-methylimidazo[1,2-a]pyridine-3-carboxylic acid hydrazide
Description:
6-Chloro-1,8a-dihydro-2-methylimidazo[1,2-a]pyridine-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes an imidazo-pyridine core and a hydrazide functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in various organic solvents. The presence of the chloro substituent may influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The hydrazide moiety can participate in various chemical reactions, including hydrazone formation and potential applications in drug development. Additionally, the compound's structure suggests it may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its biological activity and therapeutic potential. As with many heterocycles, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a unique scaffold for further exploration in chemical and pharmaceutical research.
Formula:C9H11ClN4O
InChI:InChI=1S/C9H11ClN4O/c1-5-8(9(15)13-11)14-4-6(10)2-3-7(14)12-5/h2-4,7,12H,11H2,1H3,(H,13,15)
InChI key:InChIKey=GXGMGKUAPVLRQC-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1N2C(NC1C)C=CC(Cl)=C2
Synonyms:- Imidazo[1,2-a]pyridine-3-carboxylic acid, 6-chloro-1,8a-dihydro-2-methyl-, hydrazide
- 6-Chloro-1,8a-dihydro-2-methylimidazo[1,2-a]pyridine-3-carboxylic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Chloro-1,8a-dihydro-2-methylimidazo[1,2-a]pyridine-3-carbohydrazide
CAS:<p>6-Chloro-1,8a-dihydro-2-methylimidazo[1,2-a]pyridine-3-carbohydrazide</p>Molecular weight:226.66g/mol
