CAS 1206969-38-1
:5-(1-Methyl-1H-pyrazol-4-yl)-3-(4-piperidinyl)-1H-pyrrolo[2,3-b]pyridine
Description:
5-(1-Methyl-1H-pyrazol-4-yl)-3-(4-piperidinyl)-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its complex heterocyclic structure, which includes a pyridine ring fused with a pyrrole and substituted with a pyrazole and a piperidine moiety. This compound typically exhibits properties associated with its nitrogen-rich framework, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the piperidine group may contribute to its pharmacological properties, potentially influencing receptor interactions or enzyme inhibition. The methyl group on the pyrazole ring can enhance lipophilicity, affecting the compound's solubility and permeability. As a result, this compound may be investigated for its therapeutic potential in various diseases, particularly in areas like oncology or neurology. Its specific reactivity and stability would depend on the functional groups and the overall electronic environment within the molecule. Further studies would be necessary to elucidate its complete profile, including synthesis, characterization, and biological activity.
Formula:C16H19N5
InChI:InChI=1S/C16H19N5/c1-21-10-13(8-20-21)12-6-14-15(9-19-16(14)18-7-12)11-2-4-17-5-3-11/h6-11,17H,2-5H2,1H3,(H,18,19)
InChI key:InChIKey=WACUYHHVMHQYFE-UHFFFAOYSA-N
SMILES:CN1C=C(C=2C=C3C(=CNC3=NC2)C4CCNCC4)C=N1
Synonyms:- 5-(1-Methylpyrazol-4-yl)-3-(4-piperidyl)-1H-pyrrolo[2,3-b]pyridine
- 5-(1-Methyl-1H-pyrazol-4-yl)-3-(4-piperidinyl)-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 5-(1-methyl-1H-pyrazol-4-yl)-3-(4-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(1-Methyl-1H-pyrazol-4-yl)-3-(piperidin-4-yl)-1H-pyrrolo[2,3-b]pyridine
CAS:<p>5-(1-Methyl-1H-pyrazol-4-yl)-3-(piperidin-4-yl)-1H-pyrrolo[2,3-b]pyridine</p>Molecular weight:281.36g/mol
