CAS 1206969-50-7
:1-(5-Chloro-2-benzoxazolyl)-4-piperidinone
Description:
1-(5-Chloro-2-benzoxazolyl)-4-piperidinone is a chemical compound characterized by its unique structural features, which include a piperidinone moiety and a benzoxazole ring substituted with a chlorine atom. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, contributing to its potential biological activity. The presence of the piperidinone structure suggests that it may possess basic properties, allowing it to interact with various biological targets. The chlorine substituent on the benzoxazole ring can influence the compound's lipophilicity and reactivity, potentially enhancing its pharmacological profile. Additionally, compounds of this nature are often investigated for their roles in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. The specific interactions and stability of this compound can be influenced by factors such as pH, solvent, and temperature, making it important to consider these conditions in experimental settings. Overall, 1-(5-Chloro-2-benzoxazolyl)-4-piperidinone represents a class of compounds with significant interest in research and development.
Formula:C12H11ClN2O2
InChI:InChI=1S/C12H11ClN2O2/c13-8-1-2-11-10(7-8)14-12(17-11)15-5-3-9(16)4-6-15/h1-2,7H,3-6H2
InChI key:InChIKey=DFYIQJNIWCMLBQ-UHFFFAOYSA-N
SMILES:O=C1CCN(C=2OC=3C(N2)=CC(Cl)=CC3)CC1
Synonyms:- 1-(5-Chloro-2-benzoxazolyl)-4-piperidinone
- 4-Piperidinone, 1-(5-chloro-2-benzoxazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(5-Chlorobenzo[d]oxazol-2-yl)piperidin-4-one
CAS:1-(5-Chlorobenzo[d]oxazol-2-yl)piperidin-4-one
Molecular weight:250.68g/mol
