CAS 1206969-52-9
:1,1-Dimethylethyl 3-[[(4-cyanophenyl)methyl]amino]cyclobutanecarboxylate
Description:
1,1-Dimethylethyl 3-[[(4-cyanophenyl)methyl]amino]cyclobutanecarboxylate, identified by its CAS number 1206969-52-9, is a chemical compound characterized by its unique structural features. It contains a cyclobutane ring, which contributes to its cyclic nature and potential strain effects. The presence of a dimethyl group indicates steric hindrance, which can influence its reactivity and interactions with other molecules. The compound also features a cyanophenyl group, suggesting potential applications in organic synthesis or as a building block in pharmaceuticals due to the electron-withdrawing nature of the cyano group. The amino functionality implies that it may engage in hydrogen bonding, affecting its solubility and biological activity. Overall, this compound's structural complexity and functional groups suggest it may exhibit interesting chemical properties and potential utility in various fields, including medicinal chemistry and materials science. Further studies would be necessary to elucidate its specific reactivity, stability, and potential applications.
Formula:C17H22N2O2
InChI:InChI=1S/C17H22N2O2/c1-17(2,3)21-16(20)14-8-15(9-14)19-11-13-6-4-12(10-18)5-7-13/h4-7,14-15,19H,8-9,11H2,1-3H3
InChI key:InChIKey=CPFQEPHUNHXAFE-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)C1CC(NCC2=CC=C(C#N)C=C2)C1
Synonyms:- Cyclobutanecarboxylic acid, 3-[[(4-cyanophenyl)methyl]amino]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3-[[(4-cyanophenyl)methyl]amino]cyclobutanecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 3-(4-cyanobenzylamino)cyclobutanecarboxylate
CAS:tert-Butyl 3-(4-cyanobenzylamino)cyclobutanecarboxylate
Molecular weight:286.37g/mol
