
CAS 1206969-66-5
:3-Amino-6-ethyl-2,3-dihydro-2-thioxo-4(1H)-pyrimidinone
Description:
3-Amino-6-ethyl-2,3-dihydro-2-thioxo-4(1H)-pyrimidinone is a heterocyclic compound characterized by its pyrimidinone structure, which features a thioxo group and an amino substituent. This compound typically exhibits properties associated with pyrimidine derivatives, such as potential biological activity, including antimicrobial or antitumor effects, due to the presence of the amino group that can participate in hydrogen bonding and other interactions. The ethyl group contributes to the lipophilicity of the molecule, potentially influencing its solubility and permeability in biological systems. The thioxo moiety may enhance the reactivity of the compound, making it a candidate for further chemical modifications or applications in medicinal chemistry. Additionally, the dihydro form indicates that the compound may exist in a cyclic or partially saturated state, which can affect its stability and reactivity. Overall, this compound's unique structural features suggest it may have interesting pharmacological properties worthy of investigation.
Formula:C6H9N3OS
InChI:InChI=1S/C6H9N3OS/c1-2-4-3-5(10)9(7)6(11)8-4/h3H,2,7H2,1H3,(H,8,11)
InChI key:InChIKey=XXGYSDTWOCKKCY-UHFFFAOYSA-N
SMILES:C(C)C1=CC(=O)N(N)C(=S)N1
Synonyms:- 3-Amino-6-ethyl-2,3-dihydro-2-thioxo-4(1H)-pyrimidinone
- 4(1H)-Pyrimidinone, 3-amino-6-ethyl-2,3-dihydro-2-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.