CAS 1206969-71-2
:Methyl 4-[2-(3-hydroxyphenyl)-4-thiazolyl]benzoate
Description:
Methyl 4-[2-(3-hydroxyphenyl)-4-thiazolyl]benzoate, identified by its CAS number 1206969-71-2, is an organic compound characterized by its complex structure, which includes a methyl ester functional group, a thiazole ring, and a phenolic moiety. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic and heterocyclic components. The presence of the thiazole ring suggests potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The hydroxyl group on the phenyl ring may contribute to hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound's structure may allow for various substitution reactions, making it a candidate for further chemical modifications. Its potential applications could span medicinal chemistry, where it may serve as a lead compound for drug development, or in materials science, depending on its physical properties. Overall, Methyl 4-[2-(3-hydroxyphenyl)-4-thiazolyl]benzoate represents a versatile structure with implications in various fields of research.
Formula:C17H13NO3S
InChI:InChI=1S/C17H13NO3S/c1-21-17(20)12-7-5-11(6-8-12)15-10-22-16(18-15)13-3-2-4-14(19)9-13/h2-10,19H,1H3
InChI key:InChIKey=QXIFGFIWTDEAGS-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(C=2N=C(SC2)C3=CC(O)=CC=C3)C=C1
Synonyms:- Methyl 4-[2-(3-hydroxyphenyl)-4-thiazolyl]benzoate
- Benzoic acid, 4-[2-(3-hydroxyphenyl)-4-thiazolyl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 4-(2-(3-hydroxyphenyl)thiazol-4-yl)benzoate
CAS:Methyl 4-(2-(3-hydroxyphenyl)thiazol-4-yl)benzoate
Molecular weight:311.36g/mol
