CAS 1206969-71-2

Methyl 4-[2-(3-hydroxyphenyl)-4-thiazolyl]benzoate

Description:

Methyl 4-[2-(3-hydroxyphenyl)-4-thiazolyl]benzoate, identified by its CAS number 1206969-71-2, is an organic compound characterized by its complex structure, which includes a methyl ester functional group, a thiazole ring, and a phenolic moiety. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic and heterocyclic components. The presence of the thiazole ring suggests potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The hydroxyl group on the phenyl ring may contribute to hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound's structure may allow for various substitution reactions, making it a candidate for further chemical modifications. Its potential applications could span medicinal chemistry, where it may serve as a lead compound for drug development, or in materials science, depending on its physical properties. Overall, Methyl 4-[2-(3-hydroxyphenyl)-4-thiazolyl]benzoate represents a versatile structure with implications in various fields of research.

Formula: C₁₇H₁₃NO₃S

InChI: InChI=1S/C17H13NO3S/c1-21-17(20)12-7-5-11(6-8-12)15-10-22-16(18-15)13-3-2-4-14(19)9-13/h2-10,19H,1H3

InChI key: InChIKey=QXIFGFIWTDEAGS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC=C(C=2N=C(SC2)C3=CC(O)=CC=C3)C=C1

Synonyms:

• Methyl 4-[2-(3-hydroxyphenyl)-4-thiazolyl]benzoate
• Benzoic acid, 4-[2-(3-hydroxyphenyl)-4-thiazolyl]-, methyl ester

Methyl 4-(2-(3-hydroxyphenyl)thiazol-4-yl)benzoate

CAS: 1206969-71-2

Methyl 4-(2-(3-hydroxyphenyl)thiazol-4-yl)benzoate

Molecular weight: 311.36g/mol

Ref: 54-OR322760