CAS 1206969-77-8
:1-[(2-Bromo-4-fluorophenyl)methyl]-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one
Description:
1-[(2-Bromo-4-fluorophenyl)methyl]-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one is a chemical compound characterized by its complex structure, which includes a pyrrolopyridinone core and a substituted phenyl group. The presence of a bromine and a fluorine atom on the phenyl ring contributes to its unique electronic properties and potential reactivity. This compound is likely to exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its tetrahydro structure suggests it may have a degree of rigidity, influencing its interaction with biological targets. The specific arrangement of atoms and functional groups can affect its solubility, stability, and overall pharmacokinetic properties. As with many heterocyclic compounds, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, depending on the conditions. Understanding its characteristics is crucial for exploring its potential applications in pharmaceuticals or other fields.
Formula:C14H12BrFN2O
InChI:InChI=1S/C14H12BrFN2O/c15-12-7-10(16)2-1-9(12)8-18-6-4-11-13(18)3-5-17-14(11)19/h1-2,4,6-7H,3,5,8H2,(H,17,19)
InChI key:InChIKey=NINADCQRLPCALD-UHFFFAOYSA-N
SMILES:C(N1C2=C(C=C1)C(=O)NCC2)C3=C(Br)C=C(F)C=C3
Synonyms:- 1-[(2-Bromo-4-fluorophenyl)methyl]-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one
- 4H-Pyrrolo[3,2-c]pyridin-4-one, 1-[(2-bromo-4-fluorophenyl)methyl]-1,5,6,7-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2-Bromo-4-fluorobenzyl)-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-4(5H)-one
CAS:1-(2-Bromo-4-fluorobenzyl)-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-4(5H)-one
Molecular weight:323.16g/mol
