CymitQuimica logo

CAS 1206969-78-9

:

3-[1-[2-(Dimethylamino)ethyl]-1H-pyrazol-4-yl]benzoic acid

Description:
3-[1-[2-(Dimethylamino)ethyl]-1H-pyrazol-4-yl]benzoic acid, with the CAS number 1206969-78-9, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a pyrazole ring substituted with a dimethylaminoethyl group. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of both hydrophobic (the aromatic and pyrazole rings) and hydrophilic (the carboxylic acid group) functional groups. It may demonstrate biological activity, potentially acting as a pharmaceutical agent or a research chemical, due to the presence of the dimethylamino group, which can enhance its interaction with biological targets. The compound's stability, reactivity, and potential applications in medicinal chemistry or material science would depend on its specific functional groups and overall molecular conformation. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C14H17N3O2
InChI:InChI=1S/C14H17N3O2/c1-16(2)6-7-17-10-13(9-15-17)11-4-3-5-12(8-11)14(18)19/h3-5,8-10H,6-7H2,1-2H3,(H,18,19)
InChI key:InChIKey=HVGUERNNMJSANR-UHFFFAOYSA-N
SMILES:C(CN(C)C)N1C=C(C=N1)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • 3-[1-[2-(Dimethylamino)ethyl]-1H-pyrazol-4-yl]benzoic acid
  • Benzoic acid, 3-[1-[2-(dimethylamino)ethyl]-1H-pyrazol-4-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.