CAS 1206969-97-2
:3-[(Phenylmethyl)amino]-1,2,4-triazolo[4,3-a]pyridine-8-carboxylic acid
Description:
3-[(Phenylmethyl)amino]-1,2,4-triazolo[4,3-a]pyridine-8-carboxylic acid is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a pyridine moiety, along with a carboxylic acid functional group. This compound features a phenylmethylamino substituent, which contributes to its potential biological activity. The presence of both the triazole and pyridine rings suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand for various biological targets. The carboxylic acid group enhances its solubility in polar solvents and may influence its interaction with biological systems. Additionally, the compound's molecular structure indicates potential for hydrogen bonding and other intermolecular interactions, which are crucial for its reactivity and stability. As with many heterocyclic compounds, its synthesis and characterization would involve techniques such as NMR spectroscopy, mass spectrometry, and possibly X-ray crystallography to confirm its structure and purity. Overall, this compound may be of interest in medicinal chemistry and drug development.
Formula:C14H12N4O2
InChI:InChI=1S/C14H12N4O2/c19-13(20)11-7-4-8-18-12(11)16-17-14(18)15-9-10-5-2-1-3-6-10/h1-8H,9H2,(H,15,17)(H,19,20)
InChI key:InChIKey=UPVMFGJTIXRIRG-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)C=2N3C(C(C(O)=O)=CC=C3)=NN2
Synonyms:- 1,2,4-Triazolo[4,3-a]pyridine-8-carboxylic acid, 3-[(phenylmethyl)amino]-
- 3-[(Phenylmethyl)amino]-1,2,4-triazolo[4,3-a]pyridine-8-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(Benzylamino)-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid
CAS:3-(Benzylamino)-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid
Molecular weight:268.27g/mol
