CymitQuimica logo

CAS 1206970-13-9

:

N-[4-[(3-Chloro-2-pyrazinyl)oxy]phenyl]-2-pyridinamine

Description:
N-[4-[(3-Chloro-2-pyrazinyl)oxy]phenyl]-2-pyridinamine, with the CAS number 1206970-13-9, is a chemical compound characterized by its complex structure, which includes a pyridinamine core and a phenyl group substituted with a pyrazinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity due to the presence of nitrogen-containing rings. The chloro substituent on the pyrazine ring may influence its reactivity and solubility in various solvents. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound may also have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C15H11ClN4O
InChI:InChI=1S/C15H11ClN4O/c16-14-15(19-10-9-18-14)21-12-6-4-11(5-7-12)20-13-3-1-2-8-17-13/h1-10H,(H,17,20)
InChI key:InChIKey=LDYLVUWDLXEWSK-UHFFFAOYSA-N
SMILES:O(C=1C(Cl)=NC=CN1)C2=CC=C(NC3=CC=CC=N3)C=C2
Synonyms:
  • 2-Pyridinamine, N-[4-[(3-chloro-2-pyrazinyl)oxy]phenyl]-
  • N-[4-[(3-Chloro-2-pyrazinyl)oxy]phenyl]-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.