CymitQuimica logo

CAS 1206970-18-4

:

3-(6-Chloro-2-pyrazinyl)imidazo[1,2-a]pyridine

Description:
3-(6-Chloro-2-pyrazinyl)imidazo[1,2-a]pyridine is a heterocyclic compound characterized by its complex structure, which includes both imidazole and pyridine rings fused with a pyrazine moiety. This compound features a chlorine substituent at the 6-position of the pyrazine ring, which can influence its reactivity and biological activity. The presence of multiple nitrogen atoms in its structure contributes to its potential as a ligand in coordination chemistry and its utility in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various biological activities, including antimicrobial or anticancer properties, due to its ability to interact with biological targets. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular conformation. As with many heterocycles, the electronic properties imparted by the nitrogen atoms can affect its interaction with enzymes and receptors, making it a subject of interest in drug discovery and development.
Formula:C11H7ClN4
InChI:InChI=1S/C11H7ClN4/c12-10-7-13-5-8(15-10)9-6-14-11-3-1-2-4-16(9)11/h1-7H
InChI key:InChIKey=MEWJYRWDPYIXCV-UHFFFAOYSA-N
SMILES:ClC=1N=C(C=2N3C(=NC2)C=CC=C3)C=NC1
Synonyms:
  • 2-Chloro-6-[imidazo[1,2-a]pyridin-3-yl]pyrazine
  • Imidazo[1,2-a]pyridine, 3-(6-chloro-2-pyrazinyl)-
  • 3-(6-Chloro-2-pyrazinyl)imidazo[1,2-a]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.