CAS 1206970-23-1

2-(3-Methoxyphenyl)-6-(4-piperidinylmethoxy)pyrazine

Description:

2-(3-Methoxyphenyl)-6-(4-piperidinylmethoxy)pyrazine is a chemical compound characterized by its complex structure, which includes a pyrazine ring substituted with both a methoxyphenyl group and a piperidinylmethoxy group. This compound typically exhibits properties associated with its aromatic and heterocyclic components, such as potential biological activity and solubility in organic solvents. The presence of the methoxy group can enhance lipophilicity, while the piperidine moiety may contribute to its pharmacological profile, possibly influencing receptor interactions or enzyme inhibition. The compound's molecular structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. Additionally, its unique combination of functional groups may impart specific reactivity or stability characteristics, making it a candidate for further research in drug design and synthesis. As with many organic compounds, its behavior in various environments, including stability under different pH conditions and temperature, would be essential for practical applications.

Formula: C₁₇H₂₁N₃O₂

InChI: InChI=1S/C17H21N3O2/c1-21-15-4-2-3-14(9-15)16-10-19-11-17(20-16)22-12-13-5-7-18-8-6-13/h2-4,9-11,13,18H,5-8,12H2,1H3

InChI key: InChIKey=MTPAIQNZPBXDEW-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C=2N=C(C=NC2)C3=CC(OC)=CC=C3

Synonyms:

• 2-(3-Methoxyphenyl)-6-(4-piperidinylmethoxy)pyrazine
• Pyrazine, 2-(3-methoxyphenyl)-6-(4-piperidinylmethoxy)-