CymitQuimica logo

CAS 1206970-30-0

:

4-(2-Chloro-4-pyrimidinyl)-2-(4-morpholinyl)benzonitrile

Description:
4-(2-Chloro-4-pyrimidinyl)-2-(4-morpholinyl)benzonitrile, with the CAS number 1206970-30-0, is a chemical compound characterized by its complex structure, which includes a pyrimidine ring, a morpholine moiety, and a benzonitrile group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research, particularly in the development of targeted therapies. The presence of the chloro substituent on the pyrimidine ring may influence its reactivity and interaction with biological targets. Additionally, the morpholine group can enhance the compound's pharmacokinetic properties, such as permeability and stability. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry, particularly in the design of novel therapeutic agents. As with many chemical substances, safety data and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H13ClN4O
InChI:InChI=1S/C15H13ClN4O/c16-15-18-4-3-13(19-15)11-1-2-12(10-17)14(9-11)20-5-7-21-8-6-20/h1-4,9H,5-8H2
InChI key:InChIKey=NRFLVUANIKTDGL-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=C(C=C1)C2=NC(Cl)=NC=C2)N3CCOCC3
Synonyms:
  • 4-(2-Chloro-4-pyrimidinyl)-2-(4-morpholinyl)benzonitrile
  • Benzonitrile, 4-(2-chloro-4-pyrimidinyl)-2-(4-morpholinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.