
CAS 1206970-34-4
:5-[2-Chloro-5-(trifluoromethyl)phenyl]-2,3-dihydro-1H-isoindole
Description:
5-[2-Chloro-5-(trifluoromethyl)phenyl]-2,3-dihydro-1H-isoindole is a chemical compound characterized by its complex structure, which includes an isoindole core fused with a chlorinated phenyl group that possesses a trifluoromethyl substituent. This compound typically exhibits properties associated with aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the chlorine and trifluoromethyl groups. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing the compound's biological activity. The chlorinated phenyl moiety may also contribute to the compound's overall reactivity and interaction with biological targets. In terms of applications, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects, particularly in the development of pharmaceuticals. Additionally, the presence of halogens can affect the solubility and partitioning behavior of the compound in various solvents, which is crucial for its application in drug formulation and delivery.
Formula:C15H11ClF3N
InChI:InChI=1S/C15H11ClF3N/c16-14-4-3-12(15(17,18)19)6-13(14)9-1-2-10-7-20-8-11(10)5-9/h1-6,20H,7-8H2
InChI key:InChIKey=RWCIBMPIGBNZLQ-UHFFFAOYSA-N
SMILES:ClC=1C(C=2C=C3C(=CC2)CNC3)=CC(C(F)(F)F)=CC1
Synonyms:- 1H-Isoindole, 5-[2-chloro-5-(trifluoromethyl)phenyl]-2,3-dihydro-
- 5-[2-Chloro-5-(trifluoromethyl)phenyl]-2,3-dihydro-1H-isoindole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.