CymitQuimica logo

CAS 1206970-37-7

:

3-(2-Fluorophenyl)-1,2,4-triazolo[4,3-a]pyridine-8-carboxylic acid

Description:
3-(2-Fluorophenyl)-1,2,4-triazolo[4,3-a]pyridine-8-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a pyridine moiety. The presence of the 2-fluorophenyl group contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound features a carboxylic acid functional group, which can participate in hydrogen bonding and may enhance its solubility in polar solvents. The triazole and pyridine rings are known for their roles in various biological activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, the fluorine atom may enhance lipophilicity and metabolic stability, which are desirable traits in drug design. Overall, this compound exemplifies the intricate interplay of functional groups and ring systems that can lead to diverse chemical behaviors and potential applications in various fields, including drug discovery and development.
Formula:C13H8FN3O2
InChI:InChI=1S/C13H8FN3O2/c14-10-6-2-1-4-8(10)11-15-16-12-9(13(18)19)5-3-7-17(11)12/h1-7H,(H,18,19)
InChI key:InChIKey=MRIAJCBLWJJPQC-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2N(C(=NN2)C3=C(F)C=CC=C3)C=CC1
Synonyms:
  • 1,2,4-Triazolo[4,3-a]pyridine-8-carboxylic acid, 3-(2-fluorophenyl)-
  • 3-(2-Fluorophenyl)-1,2,4-triazolo[4,3-a]pyridine-8-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.