CAS 1206970-43-5
:2-Chloro-4-[3-methoxy-4-(phenylmethoxy)phenoxy]pyridine
Description:
2-Chloro-4-[3-methoxy-4-(phenylmethoxy)phenoxy]pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chloro group and a phenoxy moiety. This compound features a methoxy group and a phenylmethoxy group, contributing to its potential as a versatile building block in organic synthesis. The presence of the chloro substituent may enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The compound's molecular structure suggests it may exhibit interesting biological activities, potentially serving as a lead compound in pharmaceutical research. Its solubility and stability in different solvents can vary, influencing its application in laboratory settings. Additionally, the presence of multiple functional groups indicates that it may participate in a range of chemical interactions, making it a candidate for further studies in medicinal chemistry and material science. As with any chemical substance, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C19H16ClNO3
InChI:InChI=1S/C19H16ClNO3/c1-22-18-11-15(24-16-9-10-21-19(20)12-16)7-8-17(18)23-13-14-5-3-2-4-6-14/h2-12H,13H2,1H3
InChI key:InChIKey=CDHJWHLGYRZADX-UHFFFAOYSA-N
SMILES:O(C1=CC(OC)=C(OCC2=CC=CC=C2)C=C1)C=3C=C(Cl)N=CC3
Synonyms:- Pyridine, 2-chloro-4-[3-methoxy-4-(phenylmethoxy)phenoxy]-
- 2-Chloro-4-[3-methoxy-4-(phenylmethoxy)phenoxy]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(4-(Benzyloxy)-3-methoxyphenoxy)-2-chloropyridine
CAS:4-(4-(Benzyloxy)-3-methoxyphenoxy)-2-chloropyridine
Molecular weight:341.79g/mol
