CAS 1206970-50-4
:4-(1-Methyl-1H-pyrazol-5-yl)phenol
Description:
4-(1-Methyl-1H-pyrazol-5-yl)phenol, identified by its CAS number 1206970-50-4, is an organic compound characterized by the presence of a phenolic group and a pyrazole moiety. This compound features a phenol ring substituted with a 1-methyl-1H-pyrazol-5-yl group, which contributes to its unique chemical properties. It typically exhibits moderate solubility in organic solvents and may show limited solubility in water due to the hydrophobic nature of the pyrazole ring. The presence of the hydroxyl (-OH) group in the phenol structure imparts acidity, allowing it to participate in hydrogen bonding and potentially influencing its reactivity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. Its stability, reactivity, and specific applications would depend on the conditions under which it is used, including pH, temperature, and the presence of other reagents.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-12-10(6-7-11-12)8-2-4-9(13)5-3-8/h2-7,13H,1H3
InChI key:InChIKey=PCRBPOLMFGKTFE-UHFFFAOYSA-N
SMILES:CN1C(=CC=N1)C2=CC=C(O)C=C2
Synonyms:- 4-(1-Methyl-1H-pyrazol-5-yl)phenol
- Phenol, 4-(1-methyl-1H-pyrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(1-Methyl-1H-pyrazol-5-yl)phenol
CAS:<p>4-(1-Methyl-1H-pyrazol-5-yl)phenol</p>Molecular weight:174.20g/mol
