CAS 1206970-55-9
:6-Chloro-1-cyclopentyl-N-cyclopropyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Description:
6-Chloro-1-cyclopentyl-N-cyclopropyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo[3,4-d]pyrimidine core. This compound features a chlorine atom at the 6-position and two distinct alkyl groups: a cyclopentyl group at the 1-position and a cyclopropyl group at the N-position. The presence of these substituents contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure suggests it may interact with various biological targets, possibly influencing pathways related to cell signaling or enzyme activity. Its specific properties, such as solubility, stability, and reactivity, would depend on the molecular interactions dictated by its functional groups and overall conformation. As with many compounds in this class, further studies would be necessary to elucidate its pharmacological profile and potential applications in drug development.
Formula:C13H16ClN5
InChI:InChI=1S/C13H16ClN5/c14-13-17-11(16-8-5-6-8)10-7-15-19(12(10)18-13)9-3-1-2-4-9/h7-9H,1-6H2,(H,16,17,18)
InChI key:InChIKey=USMGOXZFHLAOOJ-UHFFFAOYSA-N
SMILES:N(C1=C2C(N(N=C2)C3CCCC3)=NC(Cl)=N1)C4CC4
Synonyms:- 1H-Pyrazolo[3,4-d]pyrimidin-4-amine, 6-chloro-1-cyclopentyl-N-cyclopropyl-
- 6-Chloro-1-cyclopentyl-N-cyclopropyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Chloro-1-cyclopentyl-n-cyclopropyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
CAS:6-Chloro-1-cyclopentyl-n-cyclopropyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Molecular weight:277.75g/mol
