CymitQuimica logo

CAS 1206970-58-2

:

3-Propyl-1,2,4-triazolo[4,3-a]pyridine-8-carboxylic acid

Description:
3-Propyl-1,2,4-triazolo[4,3-a]pyridine-8-carboxylic acid is a heterocyclic compound characterized by its triazole and pyridine rings, which contribute to its unique chemical properties. This compound features a propyl group that enhances its lipophilicity, potentially influencing its biological activity and solubility. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions, making it a potential candidate for various chemical transformations. Its structure suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand or inhibitor in biological systems. The compound's molecular framework allows for various interactions, including hydrogen bonding and π-π stacking, which can be significant in drug design and development. Additionally, the specific arrangement of atoms and functional groups may confer selectivity in biological interactions, making it a subject of interest in medicinal chemistry. Overall, 3-Propyl-1,2,4-triazolo[4,3-a]pyridine-8-carboxylic acid represents a versatile scaffold for further exploration in both synthetic and medicinal chemistry.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c1-2-4-8-11-12-9-7(10(14)15)5-3-6-13(8)9/h3,5-6H,2,4H2,1H3,(H,14,15)
InChI key:InChIKey=LYWFOVMQGYHPKB-UHFFFAOYSA-N
SMILES:C(CC)C=1N2C(C(C(O)=O)=CC=C2)=NN1
Synonyms:
  • 3-Propyl-1,2,4-triazolo[4,3-a]pyridine-8-carboxylic acid
  • 1,2,4-Triazolo[4,3-a]pyridine-8-carboxylic acid, 3-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.