CAS 1206970-71-9
:4-[(6,7-Dimethoxy-4-quinolinyl)oxy]-2-methoxyphenol
Description:
4-[(6,7-Dimethoxy-4-quinolinyl)oxy]-2-methoxyphenol, identified by its CAS number 1206970-71-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline moiety and multiple methoxy groups. This compound typically exhibits properties associated with phenolic compounds, such as potential antioxidant activity and the ability to participate in various chemical reactions due to the presence of hydroxyl groups. The dimethoxy substitutions on the quinoline ring may enhance its lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound represents a class of molecules that may possess significant therapeutic potential, warranting further investigation into its pharmacological properties and mechanisms of action.
Formula:C18H17NO5
InChI:InChI=1S/C18H17NO5/c1-21-16-8-11(4-5-14(16)20)24-15-6-7-19-13-10-18(23-3)17(22-2)9-12(13)15/h4-10,20H,1-3H3
InChI key:InChIKey=FOEUYTSPWSGRJP-UHFFFAOYSA-N
SMILES:O(C=1C2=C(C=C(OC)C(OC)=C2)N=CC1)C3=CC(OC)=C(O)C=C3
Synonyms:- Phenol, 4-[(6,7-dimethoxy-4-quinolinyl)oxy]-2-methoxy-
- 4-[(6,7-Dimethoxy-4-quinolinyl)oxy]-2-methoxyphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(6,7-Dimethoxyquinolin-4-yloxy)-2-methoxyphenol
CAS:4-(6,7-Dimethoxyquinolin-4-yloxy)-2-methoxyphenol
Molecular weight:327.33g/mol
