CAS 1206973-17-2

Methyl thiazolo[4,5-c]pyridine-6-carboxylate

Description:

Methyl thiazolo[4,5-c]pyridine-6-carboxylate is a heterocyclic organic compound characterized by its unique thiazole and pyridine ring structures. This compound features a methyl ester functional group, which contributes to its reactivity and solubility in various organic solvents. The thiazole ring, containing both sulfur and nitrogen atoms, imparts specific electronic properties, making it of interest in medicinal chemistry and drug development. The presence of the carboxylate group enhances its potential for further chemical modifications, allowing for the synthesis of derivatives with varied biological activities. Methyl thiazolo[4,5-c]pyridine-6-carboxylate may exhibit interesting pharmacological properties, including antimicrobial or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential applications in the development of agrochemicals or pharmaceuticals, particularly in targeting specific biological pathways. As with many heterocycles, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest for further research in organic synthesis and medicinal applications.

Formula: C₈H₆N₂O₂S

InChI: InChI=1S/C8H6N2O2S/c1-12-8(11)5-2-7-6(3-9-5)10-4-13-7/h2-4H,1H3

InChI key: InChIKey=HNNSZAPLWHCQLY-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C2C(=CN1)N=CS2

Synonyms:

• Methyl thiazolo[4,5-c]pyridine-6-carboxylate
• Thiazolo[4,5-c]pyridine-6-carboxylic acid, methyl ester