CAS 1206974-46-0

1H-Pyrazolo[4,3-b]pyridin-5-amine

Description:

1H-Pyrazolo[4,3-b]pyridin-5-amine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings. This compound features an amino group at the 5-position of the pyrazole ring, which contributes to its potential reactivity and biological activity. It is typically a crystalline solid, and its molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug development. The presence of the pyrazole and pyridine moieties suggests potential applications in the synthesis of pharmaceuticals, particularly in targeting specific biological pathways. Additionally, the compound may exhibit properties such as solubility in polar solvents and moderate stability under standard laboratory conditions. Its unique structure can facilitate interactions with biological targets, making it a candidate for further research in therapeutic applications. As with many heterocycles, the compound's properties can be influenced by substituents and the overall molecular environment, which may affect its pharmacokinetics and pharmacodynamics.

Formula: C₆H₆N₄

InChI: InChI=1S/C6H6N4/c7-6-2-1-4-5(9-6)3-8-10-4/h1-3H,(H2,7,9)(H,8,10)

SMILES: c1cc(=N)[nH]c2c[nH]nc12

1H-Pyrazolo[4,3-b]pyridin-5-amine

CAS: 1206974-46-0

Formula: C₆H₆N₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 134.1386

Ref: IN-DA0095VV

5-Amino-1H-pyrazolo[4,3-b]pyridine

CAS: 1206974-46-0

5-Amino-1H-pyrazolo[4,3-b]pyridine

Formula: C₆H₆N₄

Purity: 97%

Color and Shape: yellow solid

Molecular weight: 134.14g/mol

Ref: 54-OR305329

1H-PYRAZOLO[4,3-B]PYRIDIN-5-AMINE

CAS: 1206974-46-0

Purity: 97%

Molecular weight: 134.1419983

Ref: 10-F800135

5-Amino-1H-pyrazolo[4,3-b]pyridine

CAS: 1206974-46-0

5-Amino-1H-pyrazolo[4,3-b]pyridine is a pyrimidine derivative that can be synthesized from cyanoacetamide and oxalyl chloride. This compound reacts with malononitrile to produce an annulated intermediate that undergoes cyclocondensation with chloroacetaldehyde to form the final product. The synthesis of 5-amino-1H-pyrazolo[4,3-b]pyridine involves the reaction of amides or nitriles with orthoesters or bromopyruvate.

Formula: C₆H₆N₄

Purity: Min. 95%

Molecular weight: 134.14 g/mol

Ref: 3D-GYB97446