CAS 1206984-00-0

Methyl 2-(4-bromophenyl)-5-oxazolecarboxylate

Description:

Methyl 2-(4-bromophenyl)-5-oxazolecarboxylate is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of the 4-bromophenyl group indicates that there is a bromine atom attached to a phenyl ring, which can influence the compound's reactivity and physical properties. This compound typically exhibits moderate solubility in organic solvents due to its polar functional groups, while its aromatic and heterocyclic components contribute to its stability and potential for various chemical reactions, such as electrophilic substitution. Methyl esters, like this compound, are often used in synthetic organic chemistry as intermediates or building blocks for more complex molecules. Additionally, the bromine substituent can enhance the compound's biological activity, making it of interest in pharmaceutical research. Overall, Methyl 2-(4-bromophenyl)-5-oxazolecarboxylate is a versatile compound with applications in both synthetic chemistry and medicinal chemistry.

Formula: C₁₁H₈BrNO₃

InChI: InChI=1S/C11H8BrNO3/c1-15-11(14)9-6-13-10(16-9)7-2-4-8(12)5-3-7/h2-6H,1H3

InChI key: InChIKey=HYSJNXQDPDRMRI-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1OC(=NC1)C2=CC=C(Br)C=C2

Synonyms:

• 2-(4-Bromo-phenyl)-oxazole-5-carboxylic acid methyl ester
• Methyl 2-(4-bromophenyl)-5-oxazolecarboxylate
• 5-Oxazolecarboxylic acid, 2-(4-bromophenyl)-, methyl ester