CAS 1207-15-4
:Dimethyldibenzothiophene
Description:
Dimethyldibenzothiophene, with the CAS number 1207-15-4, is an organic compound that belongs to the class of dibenzothiophenes, which are polycyclic aromatic sulfur compounds. This substance features a dibenzothiophene core structure, characterized by two benzene rings fused to a thiophene ring, with two methyl groups attached at specific positions on the aromatic system. Dimethyldibenzothiophene is typically a colorless to pale yellow liquid or solid, depending on its specific isomeric form and temperature. It is insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. This compound is of interest in various fields, including petrochemicals and environmental chemistry, as it can be found in fossil fuels and is studied for its potential environmental impact and behavior during combustion processes. Additionally, its structural characteristics make it relevant in the synthesis of other chemical compounds and materials. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C14H12S
InChI:InChI=1/C14H12S/c1-9-3-5-13-11(7-9)12-8-10(2)4-6-14(12)15-13/h3-8H,1-2H3
SMILES:Cc1ccc2c(c1)c1cc(C)ccc1s2
Synonyms:- 2,8-Dimethyldibenzothiophene
- 2,8-Dimethyldibenzo[B,D]Thiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,8-Dimethyldibenzothiophene
CAS:Formula:C14H12SPurity:>97.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:212.312,8-Dimethyldibenzo[b,d]thiophene
CAS:Formula:C14H12SPurity:97%Color and Shape:SolidMolecular weight:212.31012,8-Dimethyldibenzothiophene
CAS:<p>2,8-Dimethyldibenzothiophene</p>Purity:≥95%Color and Shape:White-Pale Yellow CrystalsMolecular weight:212.31g/mol2,8-Dimethyldibenzothiophene
CAS:<p>Applications 2,8-Dimethyldibenzothiophene is used as a sulfur source in microbiology experiments conducted with desulfurizing bacterium.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Kobayashi, M., et al.: FEMS Microbiol. Lett., 18, 123 (2000); Ohshiro, T., et al.: Microbiol. Lett., 142, 65 (1996);<br></p>Formula:C14H12SColor and Shape:NeatMolecular weight:212.3101




