CymitQuimica logo

CAS 1207-75-6

:

3-(2-Hydroxyethyl)-2,4(1H,3H)-quinazolinedione

Description:
3-(2-Hydroxyethyl)-2,4(1H,3H)-quinazolinedione, also known as a derivative of quinazoline, is a chemical compound characterized by its unique bicyclic structure that includes a quinazoline core. This compound features a hydroxyl group and an ethyl group, which contribute to its solubility and reactivity. It typically exhibits properties such as moderate polarity due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The compound may display biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Its molecular structure allows for potential interactions with biological macromolecules, influencing its pharmacological properties. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 3-(2-Hydroxyethyl)-2,4(1H,3H)-quinazolinedione is a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its applications and mechanisms of action.
Formula:C10H10N2O3
InChI:InChI=1/C10H10N2O3/c13-6-5-12-9(14)7-3-1-2-4-8(7)11-10(12)15/h1-4,13H,5-6H2,(H,11,15)
InChI key:InChIKey=DSUNWRHRAQZLNC-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(=O)N1CCO)=CC=CC2
Synonyms:
  • 2,4(1H,3H)-Quinazolinedione, 3-(2-hydroxyethyl)-
  • 2,4-Dioxo-3-(2-hydroxyethyl)-1,2,3,4-tetrahydroquinazolin
  • 3-(2-Hydroxyethyl)-2,4(1H,3H)-quinazolinedione
  • 3-(2-hydroxyethyl)quinazoline-2,4(1H,3H)-dione
  • 3-(2-Hydroxyethyl)-1H,3H-quinazoline-2,4-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.