CAS 1207-81-4

4-CHLORO-2-METHYL-6-NITROQUINOLINE

Description:

4-Chloro-2-methyl-6-nitroquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 4-position, a methyl group at the 2-position, and a nitro group at the 6-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is known for its potential applications in pharmaceuticals and agrochemicals, particularly as an intermediate in the synthesis of various bioactive molecules. Its nitro group can participate in electrophilic aromatic substitution reactions, while the chlorine and methyl groups can influence its reactivity and solubility. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as compounds with nitro and chloro substituents can pose health and environmental risks. Proper handling and disposal procedures are essential when working with this substance.

Formula: C₁₀H₇ClN₂O₂

InChI: InChI=1/C10H7ClN2O2/c1-6-4-9(11)8-5-7(13(14)15)2-3-10(8)12-6/h2-5H,1H3

SMILES: Cc1cc(c2cc(ccc2n1)N(=O)=O)Cl

Synonyms:

• Akos Bbs-00000122
• Iflab-Bb F1901-0064

4-Chloro-2-methyl-6-nitroquinoline

CAS: 1207-81-4

4-Chloro-2-methyl-6-nitroquinoline

Purity: ≥95%

Molecular weight: 222.62778g/mol

Ref: 54-OR1075957

4-Chloro-2-methyl-6-nitroquinoline

CAS: 1207-81-4

Formula: C₁₀H₇ClN₂O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 222.63

Ref: 10-F494701

4-Chloro-2-methyl-6-nitroquinoline

CAS: 1207-81-4

4-Chloro-2-methyl-6-nitroquinoline is an antimicrobial agent that exhibits a broad spectrum of activity against both gram-positive and gram-negative bacteria. It also has antifungal properties. 4-Chloro-2-methyl-6-nitroquinoline inhibits the growth of bacteria by binding to DNA and RNA in the bacterial cell, thereby inhibiting transcription and replication. It also inhibits the synthesis of proteins in fungi, which may be due to its ability to bind to fungal ribosomes and inhibit protein synthesis.

Formula: C₁₀H₇ClN₂O₂

Purity: Min. 95%

Molecular weight: 222.63 g/mol

Ref: 3D-BAA20781