CAS 120705-68-2
:4-Thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 6-[1-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-7-oxo-3-(tetrahydro-2-furanyl)-, 2-propenyl ester, [5R-[3(S*),5α,6α(R*)]]-
Description:
4-Thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 6-[1-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-7-oxo-3-(tetrahydro-2-furanyl)-, 2-propenyl ester, with CAS number 120705-68-2, is a complex organic compound characterized by its bicyclic structure, which incorporates both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of a silyl ether group indicates that it may exhibit unique solubility and stability properties, particularly in organic solvents. The tetrahydrofuran moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions or cycloadditions. Additionally, the compound's stereochemistry, denoted by the specific configuration at certain chiral centers, may influence its biological activity and interactions with other molecules. Overall, this compound's intricate structure and functional groups suggest potential applications in medicinal chemistry or as a synthetic intermediate in organic synthesis.
Formula:C21H33NO5SSi
InChI:InChI=1S/C21H33NO5SSi/c1-8-11-26-20(24)16-17(14-10-9-12-25-14)28-19-15(18(23)22(16)19)13(2)27-29(6,7)21(3,4)5/h8,13-15,19H,1,9-12H2,2-7H3/t13-,14+,15+,19-/m1/s1
InChI key:InChIKey=MASHLNCIEFIURF-MMMWYMCRSA-N
SMILES:C(OCC=C)(=O)C=1N2[C@@]([C@@]([C@H](O[Si](C(C)(C)C)(C)C)C)(C2=O)[H])(SC1[C@@H]3CCCO3)[H]
Synonyms:- 4-Thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 6-[1-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-7-oxo-3-(tetrahydro-2-furanyl)-, 2-propenyl ester, [5R-[3(S*),5α,6α(R*)]]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Faropenem Impurity 7
CAS:Formula:C21H33NO5SSiColor and Shape:White To Off-White SolidMolecular weight:439.65
