CymitQuimica logo

CAS 120705-71-7

:

6-[1-[(tert-Butyldimethylsilyl)oxy]ethyl]-7-oxo-3-(tetrahydro-3-furanyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid 2-propenyl ester

Description:
The chemical substance known as 6-[1-[(tert-Butyldimethylsilyl)oxy]ethyl]-7-oxo-3-(tetrahydro-3-furanyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid 2-propenyl ester, with the CAS number 120705-71-7, is a complex organic compound characterized by its unique bicyclic structure and functional groups. It features a thiazolidine ring, which contributes to its potential biological activity. The presence of a tert-butyldimethylsilyl group suggests that the compound may exhibit enhanced stability and solubility, making it suitable for various chemical reactions or applications. The tetrahydrofuran moiety indicates potential interactions with biological systems, possibly influencing its pharmacological properties. Additionally, the carboxylic acid and ester functionalities imply that the compound may participate in esterification or hydrolysis reactions. Overall, this compound's intricate structure and functional groups suggest it may have applications in medicinal chemistry or as a synthetic intermediate in organic synthesis. However, specific biological activity and reactivity would require further investigation through empirical studies.
Formula:C21H33NO5SSi
InChI:InChI=1/C21H33NO5SSi/c1-8-10-26-20(24)16-17(14-9-11-25-12-14)28-19-15(18(23)22(16)19)13(2)27-29(6,7)21(3,4)5/h8,13-15,19H,1,9-12H2,2-7H3
SMILES:C=CCOC(=O)C1=C(C2CCOC2)SC2C(C(C)O[Si](C)(C)C(C)(C)C)C(=O)N12
Synonyms:
  • 6-(1'-(T-Butyldimethylsilyloxy)Ethyl)-2-(2'-Tetrahydrofuran)Penem-3-Allyl Carboxylate
  • Ally(1R,2R,5R,6S)-6-(1'-tert-Butyldimethylsilyloxyethyl)-2-(2'-tetrahydrofuranyl)penem-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.