CAS 120711-97-9

1-(6-Amino-2,3-dihydro-4H-1,4-benzoxazin-4-yl)ethanone

Description:

1-(6-Amino-2,3-dihydro-4H-1,4-benzoxazin-4-yl)ethanone, with the CAS number 120711-97-9, is a chemical compound characterized by its unique structure that includes a benzoxazine ring fused with an amino group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and can act as a nucleophile in various chemical reactions. Additionally, the ethanone moiety indicates that it has ketone functionality, which can influence its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. Its solubility, stability, and reactivity would depend on the solvent and environmental conditions, making it a candidate for further research in drug development or material science. Overall, its unique characteristics make it a subject of interest in various fields of chemistry.

Formula: C₁₀H₁₂N₂O₂

InChI: InChI=1S/C10H12N2O2/c1-7(13)12-4-5-14-10-3-2-8(11)6-9(10)12/h2-3,6H,4-5,11H2,1H3

InChI key: InChIKey=YLCDUHZQBPGRFA-UHFFFAOYSA-N

SMILES: C(C)(=O)N1C=2C(=CC=C(N)C2)OCC1

Synonyms:

• Ethanone, 1-(6-amino-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-
• 1-(6-Amino-2,3-dihydro-4H-1,4-benzoxazin-4-yl)ethanone
• 4-Acetyl-6-amino-3,4-dihydro-2H-benzo[1,4]oxazine
• 2H-1,4-Benzoxazin-6-amine, 4-acetyl-3,4-dihydro-
• 1-[6-Amino-2H-benzo[b][1,4]oxazin-4(3H)-yl]ethanone