CAS 120715-48-2

4,5,6,7-Tetrahydro-3-methoxybenzo[b]thiophene-2-carboxylic acid

Description:

4,5,6,7-Tetrahydro-3-methoxybenzo[b]thiophene-2-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a thiophene ring fused to a benzene-like system. This compound features a methoxy group (-OCH3) and a carboxylic acid group (-COOH), contributing to its chemical reactivity and potential biological activity. The presence of the methoxy group can influence its solubility and polarity, while the carboxylic acid group can participate in hydrogen bonding and acid-base reactions. The tetrahydro configuration indicates that the compound is saturated, which may affect its stability and reactivity compared to unsaturated analogs. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific applications and interactions would depend on further studies, including its synthesis, biological activity, and potential therapeutic uses. Overall, 4,5,6,7-Tetrahydro-3-methoxybenzo[b]thiophene-2-carboxylic acid represents a complex structure with diverse chemical characteristics.

Formula: C₁₀H₁₂O₃S

InChI: InChI=1S/C10H12O3S/c1-13-8-6-4-2-3-5-7(6)14-9(8)10(11)12/h2-5H2,1H3,(H,11,12)

InChI key: InChIKey=NISAZBAHPFVIPA-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(SC1C(O)=O)CCCC2

Synonyms:

• 3-Methoxy-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid
• 4,5,6,7-Tetrahydro-3-methoxybenzo[b]thiophene-2-carboxylic acid
• 3-Methoxy-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid
• Benzo[b]thiophene-2-carboxylic acid, 4,5,6,7-tetrahydro-3-methoxy-
• 3-Methoxy-4,5,6,7-tetrahydro-benzo[b]thiophene-2-carboxylic acid