CymitQuimica logo

CAS 120717-37-5

:

2-(methylsulfanyl)-5-(tributylstannanyl)pyrimidine

Description:
2-(Methylsulfanyl)-5-(tributylstannanyl)pyrimidine is a chemical compound characterized by its pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a methylsulfanyl group at position 2 introduces a sulfur atom, contributing to the compound's reactivity and potential applications in organic synthesis. The tributylstannanyl group at position 5 indicates the presence of a tin atom bonded to three butyl groups, which enhances the compound's utility in organometallic chemistry and may facilitate various coupling reactions. This compound is likely to exhibit moderate to low solubility in water due to its hydrophobic tributyl groups, while being more soluble in organic solvents. Its unique structure suggests potential applications in medicinal chemistry, materials science, or as a precursor in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of organotin compounds, which can be toxic and environmentally hazardous.
Formula:C17H32N2SSn
InChI:InChI=1/C5H5N2S.3C4H9.Sn/c1-8-5-6-3-2-4-7-5;3*1-3-4-2;/h3-4H,1H3;3*1,3-4H2,2H3;/rC17H32N2SSn/c1-5-8-11-21(12-9-6-2,13-10-7-3)16-14-18-17(20-4)19-15-16/h14-15H,5-13H2,1-4H3
SMILES:CCCC[Sn](CCCC)(CCCC)c1cnc(nc1)SC
Synonyms:
  • 2-(Methylsulfanyl)-5-(tributylstannyl)pyrimidine
  • Pyrimidine, 2-(methylthio)-5-(tributylstannyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.