CAS 1207174-86-4

5-Bromo-2-(3-oxetanyloxy)pyrimidine

Description:

5-Bromo-2-(3-oxetanyloxy)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The 2-position features a 3-oxetanyloxy group, which is a cyclic ether that can enhance the compound's solubility and stability. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyrimidine ring is a common motif in many biologically active compounds. The compound's unique functional groups may also allow for specific interactions with biological targets, making it of interest for further research. Additionally, its molecular properties, such as polarity and reactivity, can be influenced by the bromine and oxetane substituents, which may affect its behavior in various chemical environments.

Formula: C₇H₇BrN₂O₂

InChI: InChI=1S/C7H7BrN2O2/c8-5-1-9-7(10-2-5)12-6-3-11-4-6/h1-2,6H,3-4H2

InChI key: InChIKey=KJZWINUOMLGAPM-UHFFFAOYSA-N

SMILES: O(C=1N=CC(Br)=CN1)C2COC2

Synonyms:

• 5-Bromo-2-(3-oxetanyloxy)pyrimidine
• Pyrimidine, 5-bromo-2-(3-oxetanyloxy)-

5-Bromo-2-(oxetan-3-yloxy)-pyrimidine, 95%

CAS: 1207174-86-4

Formula: C₇H₇BrN₂O₂

Purity: 95%

Color and Shape: Tan Solid

Molecular weight: 231.05

Ref: 08-07-0182