CAS 1207174-95-5

6-Bromo-3-(1H-imidazol-2-yl)-1H-indazole

Description:

6-Bromo-3-(1H-imidazol-2-yl)-1H-indazole is a chemical compound characterized by its unique structure, which includes an indazole core substituted with a bromine atom and an imidazole ring. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the bromine atom can enhance its reactivity and influence its pharmacological properties, making it of interest in medicinal chemistry. The imidazole moiety may contribute to its ability to interact with biological targets, potentially leading to applications in drug development. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods. Overall, 6-Bromo-3-(1H-imidazol-2-yl)-1H-indazole represents a class of compounds that are valuable in research and development within the fields of organic and medicinal chemistry.

Formula: C₁₀H₇BrN₄

InChI: InChI=1S/C10H7BrN4/c11-6-1-2-7-8(5-6)14-15-9(7)10-12-3-4-13-10/h1-5H,(H,12,13)(H,14,15)

InChI key: InChIKey=LMUFFFSHVASUKL-UHFFFAOYSA-N

SMILES: BrC=1C=C2C(C(=NN2)C=3NC=CN3)=CC1

Synonyms:

• 1H-Indazole, 6-bromo-3-(1H-imidazol-2-yl)-
• 6-Bromo-3-(1H-imidazol-2-yl)-1H-indazole