CAS 1207175-13-0

4-Chloro-1-methyl-3-(2-methylpropyl)-1H-pyrazolo[3,4-b]pyridine

Description:

4-Chloro-1-methyl-3-(2-methylpropyl)-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. The presence of a chlorine atom at the 4-position and a branched alkyl group (2-methylpropyl) at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the reactivity of the chlorine atom and the electron-rich nature of the pyrazole ring. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Further studies would be necessary to elucidate its specific applications and biological effects.

Formula: C₁₁H₁₄ClN₃

InChI: InChI=1S/C11H14ClN3/c1-7(2)6-9-10-8(12)4-5-13-11(10)15(3)14-9/h4-5,7H,6H2,1-3H3

InChI key: InChIKey=CXGNLKNAFBVMDE-UHFFFAOYSA-N

SMILES: C(C(C)C)C=1C=2C(N(C)N1)=NC=CC2Cl

Synonyms:

• 4-Chloro-1-methyl-3-(2-methylpropyl)-1H-pyrazolo[3,4-b]pyridine
• 1H-Pyrazolo[3,4-b]pyridine, 4-chloro-1-methyl-3-(2-methylpropyl)-