CymitQuimica logo

CAS 1207175-16-3

:

4-Chloro-1-methyl-3-(2-methylpropyl)-1H-pyrazolo[4,3-c]pyridine

Description:
4-Chloro-1-methyl-3-(2-methylpropyl)-1H-pyrazolo[4,3-c]pyridine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. The presence of a chlorine atom at the 4-position and a branched alkyl group (2-methylpropyl) at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research. The compound may participate in various chemical reactions typical of heterocycles, such as electrophilic substitutions or nucleophilic attacks, due to the electron-rich nature of the nitrogen atoms in the rings. Additionally, its chlorine substituent can influence its reactivity and stability, potentially affecting its interactions in biological systems. Overall, 4-Chloro-1-methyl-3-(2-methylpropyl)-1H-pyrazolo[4,3-c]pyridine represents a class of compounds that may have applications in medicinal chemistry and drug development.
Formula:C11H14ClN3
InChI:InChI=1S/C11H14ClN3/c1-7(2)6-8-10-9(15(3)14-8)4-5-13-11(10)12/h4-5,7H,6H2,1-3H3
InChI key:InChIKey=IMLGCGNBKUQSFQ-UHFFFAOYSA-N
SMILES:C(C(C)C)C=1C=2C(N(C)N1)=CC=NC2Cl
Synonyms:
  • 4-Chloro-1-methyl-3-(2-methylpropyl)-1H-pyrazolo[4,3-c]pyridine
  • 1H-Pyrazolo[4,3-c]pyridine, 4-chloro-1-methyl-3-(2-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.