
CAS 1207175-19-6
:3-(Phenylthio)oxetane
Description:
3-(Phenylthio)oxetane is a chemical compound characterized by its oxetane ring, which is a four-membered cyclic ether. The presence of a phenylthio group at the 3-position of the oxetane ring introduces unique properties, including increased reactivity and potential for various chemical transformations. This compound is typically colorless to pale yellow and may exhibit a distinct odor. It is soluble in organic solvents, which makes it useful in various synthetic applications. The phenylthio group can participate in nucleophilic substitution reactions, making 3-(Phenylthio)oxetane a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's structure allows for potential applications in materials science, such as in the formulation of polymers or coatings. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C9H10OS
InChI:InChI=1S/C9H10OS/c1-2-4-8(5-3-1)11-9-6-10-7-9/h1-5,9H,6-7H2
InChI key:InChIKey=JSFDYQHJQCJHHX-UHFFFAOYSA-N
SMILES:S(C1=CC=CC=C1)C2COC2
Synonyms:- 3-(Phenylthio)oxetane
- Oxetane, 3-(phenylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.