
CAS 1207175-21-0
:Ethyl 2-(3-oxetanyloxy)acetate
Description:
Ethyl 2-(3-oxetanyloxy)acetate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol and a carboxylic acid. This compound features an ethyl group attached to an acetate moiety, along with a 3-oxetanyloxy substituent, indicating the presence of a four-membered cyclic ether (oxetane) linked via an ether bond. The structure suggests that it may exhibit unique reactivity due to the strain in the oxetane ring, which can influence its chemical behavior in various reactions, such as ring-opening or nucleophilic substitutions. Ethyl 2-(3-oxetanyloxy)acetate may be of interest in synthetic organic chemistry and materials science, potentially serving as an intermediate in the synthesis of more complex molecules or as a building block in polymer chemistry. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data and handling precautions should be considered, as with any chemical substance.
Formula:C7H12O4
InChI:InChI=1S/C7H12O4/c1-2-10-7(8)5-11-6-3-9-4-6/h6H,2-5H2,1H3
InChI key:InChIKey=UQWKKGRZXIXMEI-UHFFFAOYSA-N
SMILES:O(CC(OCC)=O)C1COC1
Synonyms:- Ethyl 2-(3-oxetanyloxy)acetate
- Acetic acid, 2-(3-oxetanyloxy)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.