CymitQuimica logo

CAS 1207175-56-1

:

2-[5-(4-Piperidinyl)-1,3,4-oxadiazol-2-yl]pyrazine

Description:
2-[5-(4-Piperidinyl)-1,3,4-oxadiazol-2-yl]pyrazine is a chemical compound characterized by its unique structural features, which include a pyrazine ring and an oxadiazole moiety. The presence of the piperidine group contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may have specific interactions with biological targets due to its heterocyclic nature. The oxadiazole ring is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory effects. Additionally, the compound's molecular structure suggests potential for diverse reactivity, which can be exploited in synthetic applications. As with many heterocyclic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-[5-(4-Piperidinyl)-1,3,4-oxadiazol-2-yl]pyrazine represents a class of compounds that are valuable in research and development within the pharmaceutical industry.
Formula:C11H13N5O
InChI:InChI=1S/C11H13N5O/c1-3-12-4-2-8(1)10-15-16-11(17-10)9-7-13-5-6-14-9/h5-8,12H,1-4H2
InChI key:InChIKey=NXGUSEWCMYUIES-UHFFFAOYSA-N
SMILES:C=1(OC(=NN1)C=2C=NC=CN2)C3CCNCC3
Synonyms:
  • Pyrazine, 2-[5-(4-piperidinyl)-1,3,4-oxadiazol-2-yl]-
  • 2-[5-(4-Piperidinyl)-1,3,4-oxadiazol-2-yl]pyrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.