CAS 1207175-67-4

Ethyl 2-[(4-bromophenyl)methyl]-4-thiazolecarboxylate

Description:

Ethyl 2-[(4-bromophenyl)methyl]-4-thiazolecarboxylate is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of the 4-bromophenyl group indicates that it has a bromine substituent on a phenyl ring, which can influence its electronic properties and potential biological activity. The thiazole moiety is known for its role in various biological systems and can be involved in interactions with enzymes or receptors. Ethyl 2-[(4-bromophenyl)methyl]-4-thiazolecarboxylate may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the synthesis of compounds with antimicrobial or anticancer activities. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the substance.

Formula: C₁₃H₁₂BrNO₂S

InChI: InChI=1S/C13H12BrNO2S/c1-2-17-13(16)11-8-18-12(15-11)7-9-3-5-10(14)6-4-9/h3-6,8H,2,7H2,1H3

InChI key: InChIKey=DUGFDLOSJSGBAZ-UHFFFAOYSA-N

SMILES: C(C1=NC(C(OCC)=O)=CS1)C2=CC=C(Br)C=C2

Synonyms:

• 4-Thiazolecarboxylic acid, 2-[(4-bromophenyl)methyl]-, ethyl ester
• Ethyl 2-[(4-bromophenyl)methyl]-4-thiazolecarboxylate