CAS 1207175-95-8

Methyl 4,5,6,7-tetrahydroisoxazolo[5,4-c]pyridine-3-carboxylate

Description:

Methyl 4,5,6,7-tetrahydroisoxazolo[5,4-c]pyridine-3-carboxylate is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both an isoxazole and a pyridine moiety. This compound typically exhibits a range of chemical properties, including moderate solubility in polar organic solvents due to the presence of the carboxylate group. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the tetrahydro configuration indicates that it may participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions. Additionally, the compound may exhibit specific spectral characteristics in techniques like NMR and IR spectroscopy, which can be used for its identification and characterization. As with many heterocycles, it may also display interesting pharmacological properties, although specific biological activities would require further investigation. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential applications in various fields.

Formula: C₈H₁₀N₂O₃

InChI: InChI=1S/C8H10N2O3/c1-12-8(11)7-5-2-3-9-4-6(5)13-10-7/h9H,2-4H2,1H3

InChI key: InChIKey=WRKPTPZWVKYRRD-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C2=C(ON1)CNCC2

Synonyms:

• Isoxazolo[5,4-c]pyridine-3-carboxylic acid, 4,5,6,7-tetrahydro-, methyl ester
• Methyl 4,5,6,7-tetrahydroisoxazolo[5,4-c]pyridine-3-carboxylate