CymitQuimica logo

CAS 1207176-14-4

:

7-Chloro-3-methylisoxazolo[4,5-d]pyrimidine

Description:
7-Chloro-3-methylisoxazolo[4,5-d]pyrimidine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both isoxazole and pyrimidine moieties. This compound features a chlorine atom at the 7-position and a methyl group at the 3-position of the isoxazole ring, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chlorine atom can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound is of interest in medicinal chemistry due to its potential pharmacological applications, particularly in the development of novel therapeutic agents. Its synthesis and characterization are important for understanding its reactivity and potential uses in drug discovery. As with many heterocycles, the specific interactions and stability can vary based on environmental factors such as pH and temperature.
Formula:C6H4ClN3O
InChI:InChI=1S/C6H4ClN3O/c1-3-4-5(11-10-3)6(7)9-2-8-4/h2H,1H3
InChI key:InChIKey=GRJQGAWTLNUCEV-UHFFFAOYSA-N
SMILES:ClC1=C2C(C(C)=NO2)=NC=N1
Synonyms:
  • Isoxazolo[4,5-d]pyrimidine, 7-chloro-3-methyl-
  • 7-Chloro-3-methylisoxazolo[4,5-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.