CAS 1207176-21-3

Methyl 4,7-dihydro-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-6-carboxylate

Description:

Methyl 4,7-dihydro-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-6-carboxylate is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the 4-oxo group indicates a ketone functionality, which can participate in various chemical reactions, such as nucleophilic additions. The methyl ester group enhances its solubility in organic solvents, making it suitable for various chemical processes. Additionally, the compound may exhibit biological activity, which is common among pyrimidine derivatives, potentially making it of interest in pharmaceutical research. Its molecular structure suggests that it could interact with biological targets, although specific biological activities would require further investigation. Overall, Methyl 4,7-dihydro-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-6-carboxylate is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential reactivity.

Formula: C₈H₇N₃O₃

InChI: InChI=1S/C8H7N3O3/c1-14-8(13)5-2-4-6(11-5)9-3-10-7(4)12/h2-3H,1H3,(H2,9,10,11,12)

InChI key: InChIKey=NDGDEDNPYUBXSV-UHFFFAOYSA-N

SMILES: O=C1C2=C(NC(C(OC)=O)=C2)NC=N1

Synonyms:

• Methyl 4,7-dihydro-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-6-carboxylate
• 3H-Pyrrolo[2,3-d]pyrimidine-6-carboxylic acid, 4,7-dihydro-4-oxo-, methyl ester