CymitQuimica logo

CAS 1207176-26-8

:

Furo[3,2-c]pyridine-4,6(5H,7H)-dione

Description:
Furo[3,2-c]pyridine-4,6(5H,7H)-dione is a heterocyclic organic compound characterized by its fused ring structure, which includes both furan and pyridine moieties. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups within its structure. The unique arrangement of atoms contributes to its potential reactivity and biological activity. Typically, compounds of this nature may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, making them of interest in medicinal chemistry. The presence of nitrogen in the pyridine ring can also influence the compound's electronic properties and solubility. Additionally, the specific stereochemistry and substituents can affect its interaction with biological targets. As a relatively specialized compound, Furo[3,2-c]pyridine-4,6(5H,7H)-dione may not be widely studied compared to more common organic compounds, but its unique structure suggests potential applications in pharmaceuticals and materials science. Further research would be necessary to fully elucidate its properties and potential uses.
Formula:C7H5NO3
InChI:InChI=1S/C7H5NO3/c9-6-3-5-4(1-2-11-5)7(10)8-6/h1-2H,3H2,(H,8,9,10)
InChI key:InChIKey=IZUBYOJWTPLBSX-UHFFFAOYSA-N
SMILES:O=C1C2=C(CC(=O)N1)OC=C2
Synonyms:
  • Furo[3,2-c]pyridine-4,6(5H,7H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.