CAS 1207176-30-4

Ethyl 3-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-3-oxetaneacetate

Description:

Ethyl 3-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-3-oxetaneacetate is a chemical compound characterized by its unique structure, which includes an oxetane ring, an ester functional group, and a carbamate moiety. The presence of the oxetane ring contributes to its potential reactivity and stability, while the ethyl ester group enhances its solubility in organic solvents. This compound may exhibit interesting biological activities due to the presence of the amino and carbonyl functionalities, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. Additionally, the bulky 1,1-dimethylethoxy group may influence its steric properties and overall reactivity. Ethyl 3-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-3-oxetaneacetate is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research into its properties and biological activity. As with any chemical substance, proper handling and safety precautions are essential due to potential hazards associated with its use.

Formula: C₁₃H₂₃NO₅

InChI: InChI=1S/C13H23NO5/c1-5-18-10(15)6-13(8-17-9-13)7-14-11(16)19-12(2,3)4/h5-9H2,1-4H3,(H,14,16)

InChI key: InChIKey=YRESHJZTCVBNPF-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C1(CNC(OC(C)(C)C)=O)COC1

Synonyms:

• Ethyl 3-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-3-oxetaneacetate
• 3-Oxetaneacetic acid, 3-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-, ethyl ester