CAS 1207181-59-6

Scutebata C

Description:

Scutebata C, identified by the CAS number 1207181-59-6, is a chemical compound that belongs to a class of natural products known for their diverse biological activities. While specific details about its physical and chemical properties may not be widely documented, compounds in this category often exhibit characteristics such as moderate to high molecular weight, specific solubility profiles depending on their functional groups, and potential reactivity with various biological targets. Scutebata C may possess unique structural features that contribute to its pharmacological properties, making it of interest in medicinal chemistry and drug discovery. Additionally, compounds like Scutebata C are typically studied for their potential therapeutic effects, including anti-inflammatory, antimicrobial, or anticancer activities. Further research is often necessary to fully elucidate its mechanism of action, safety profile, and potential applications in various fields, including pharmaceuticals and biotechnology.

Formula: C₂₈H₃₅NO₉

InChI: InChI=1S/C28H35NO9/c1-15-8-6-10-19-26(15,3)23(38-24(33)17-9-7-11-29-13-17)22(32)28(5,35)27(19,4)20(37-16(2)30)12-18-14-36-25(34)21(18)31/h7-9,11,13,19-20,22-23,31-32,35H,6,10,12,14H2,1-5H3/t19-,20-,22-,23-,26-,27-,28-/m0/s1

InChI key: InChIKey=ZZDJHMJHKZYAFI-MDLIPRPFSA-N

SMILES: [C@@H](CC1=C(O)C(=O)OC1)(OC(C)=O)[C@]2(C)[C@@]3([C@@](C)([C@@H](OC(=O)C=4C=CC=NC4)[C@H](O)[C@]2(C)O)C(C)=CCC3)[H]

Synonyms:

• 3-Pyridinecarboxylic acid, (1R,2S,3R,4S,4aS,8aR)-4-[(1S)-1-(acetyloxy)-2-(2,5-dihydro-4-hydroxy-5-oxo-3-furanyl)ethyl]-1,2,3,4,4a,5,6,8a-octahydro-2,3-dihydroxy-3,4,8,8a-tetramethyl-1-naphthalenyl ester
• Scutebata C

Scutebata C

CAS: 1207181-59-6

Scutebata B possesses a rare alpha-hydroxy group in its alpha,beta-unsaturated lactone rings.

Formula: C₂₈H₃₅NO₉

Purity: 98%

Color and Shape: Solid

Molecular weight: 529.58

Ref: TM-TN4975

Scutebata C

CAS: 1207181-59-6

Formula: C₂₈H₃₅NO₉

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 529.586

Ref: BP-SBP00979

Scutebata C

CAS: 1207181-59-6

Scutebata C is an insecticidal compound, which is derived from botanical sources, specifically the Scutellaria genus of plants. The compound operates primarily through neurotoxicity, targeting and disrupting the neurological pathways of insect pests by inhibiting acetylcholinesterase activity. This interference prevents the breakdown of acetylcholine, leading to the overstimulation of neural pathways and subsequent paralysis or death of the pest.

Formula: C₂₈H₃₅NO₉

Purity: Min. 95%

Molecular weight: 529.6 g/mol

Ref: 3D-HYB18159