CAS 1207181-62-1

Scutebarbatine F

Description:

Scutebarbatine F is a chemical compound classified as an alkaloid, derived from certain plant species, particularly those in the genus Scutellaria. It is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Alkaloids like Scutebarbatine F are known for their diverse pharmacological properties, including potential anti-inflammatory, analgesic, and neuroprotective effects. The compound's specific interactions with biological targets, such as receptors or enzymes, can lead to various therapeutic applications. Additionally, Scutebarbatine F may exhibit unique solubility and stability characteristics, influencing its formulation and delivery in medicinal contexts. As with many alkaloids, its safety profile, including toxicity and side effects, is an important consideration for research and potential therapeutic use. Further studies are often required to fully elucidate its mechanisms of action and potential applications in medicine.

Formula: C₃₀H₃₇NO₉

InChI: InChI=1S/C30H37NO9/c1-17-9-10-21(39-26(35)20-8-7-13-31-15-20)23-27(4)11-12-30(14-22(34)36-16-30)40-29(27,6)25(38-19(3)33)24(28(17,23)5)37-18(2)32/h7-9,13,15,21,23-25H,10-12,14,16H2,1-6H3/t21-,23-,24+,25+,27-,28+,29+,30+/m1/s1

InChI key: InChIKey=NVJGRPGPCIYGRC-LZUUMNQWSA-N

SMILES: C[C@@]12[C@@]3([C@@](C)([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]1(C)O[C@]4(CC2)COC(=O)C4)C(C)=CC[C@H]3OC(=O)C=5C=CC=NC5)[H]

Synonyms:

• 3-Pyridinecarboxylic acid, (3S,4′aR,5′S,6′R,6′aR,10′R,10′aS,10′bR)-5′,6′-bis(acetyloxy)-1′,2′,4,4′a,5,5′,6′,6′a,9′,10′,10′a,10′b-dodecahydro-4′a,6′a,7′,10′b-tetramethyl-5-oxospiro[furan-3(2H),3′-[3H]naphtho[2,1-b]pyran]-10′-yl ester
• Scutebata F
• Barbatine C
• Scutebarbatine F

Scutebata F

CAS: 1207181-62-1

Formula: C₃₀H₃₇NO₉

Molecular weight: 555.6161

Ref: IN-DA008YCT

Scutebata F

CAS: 1207181-62-1

Scutebata F is a natural product for research related to life sciences. The catalog number is TN4977 and the CAS number is 1207181-62-1.

Formula: C₃₀H₃₇NO₉

Purity: 98%

Color and Shape: Solid

Molecular weight: 555.62

Ref: TM-TN4977

Scutebata F

CAS: 1207181-62-1

Formula: C₃₀H₃₇NO₉

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 555.624

Ref: BP-SBP00739

Scutebata F

CAS: 1207181-62-1

Scutebata F is a bioinsecticide, which is a product derived from bacterial fermentation with a specific mode of action that targets insect pests. This product is formulated by harnessing the natural capabilities of microorganisms to produce compounds that are toxic to specific agricultural pests. Scutebata F operates by disrupting the physiological processes of these insects, leading to their eventual mortality. The specificity of the mode of action minimizes collateral impact on non-target organisms and beneficial insects, which is a significant advantage over broad-spectrum chemical insecticides.

Formula: C₃₀H₃₇NO₉

Purity: Min. 95%

Molecular weight: 555.6 g/mol

Ref: 3D-HYB18162