CymitQuimica logo

CAS 1207187-41-4

:

Ethyl 3-amino-6,8-dichloro-2-quinolinecarboxylate

Description:
Ethyl 3-amino-6,8-dichloro-2-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of amino and dichloro substituents at specific positions on the quinoline ring enhances its potential biological activity, making it of interest in medicinal chemistry. The dichloro groups can influence the compound's electronic properties and reactivity, while the amino group may participate in hydrogen bonding and other interactions. Ethyl 3-amino-6,8-dichloro-2-quinolinecarboxylate may exhibit various pharmacological properties, including antimicrobial or antitumor activities, although specific biological data would depend on empirical studies. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. As with many quinoline derivatives, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C12H10Cl2N2O2
InChI:InChI=1S/C12H10Cl2N2O2/c1-2-18-12(17)11-9(15)4-6-3-7(13)5-8(14)10(6)16-11/h3-5H,2,15H2,1H3
InChI key:InChIKey=OFGIRCBQEMNTBQ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(N)C(C(OCC)=O)=N2)C=C(Cl)C1
Synonyms:
  • Ethyl 3-amino-6,8-dichloro-2-quinolinecarboxylate
  • 2-Quinolinecarboxylic acid, 3-amino-6,8-dichloro-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.