
CAS 1207194-50-0
:3-Pyridinecarboxylic acid, 5-hydroxy-, ethyl ester, hydrochloride (1:1)
Description:
3-Pyridinecarboxylic acid, 5-hydroxy-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group and a hydroxyl group at specific positions on the pyridine ring, contributing to its acidic and potentially polar characteristics. The ethyl ester moiety indicates that the carboxylic acid is esterified with an ethyl group, enhancing its solubility in organic solvents. The hydrochloride form suggests that the compound is a salt formed with hydrochloric acid, which typically increases its stability and solubility in water. This compound may exhibit biological activity due to its structural features, making it of interest in pharmaceutical research. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and the presence of other functional groups. As with many pyridine derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions.
Formula:C8H9NO3·ClH
InChI:InChI=1S/C8H9NO3.ClH/c1-2-12-8(11)6-3-7(10)5-9-4-6;/h3-5,10H,2H2,1H3;1H
InChI key:InChIKey=KBWSFBRAWVACQC-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=C(O)C=NC1.Cl
Synonyms:- 3-Pyridinecarboxylic acid, 5-hydroxy-, ethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
